C21H31NO3 — CID 70541790
4-[[4-[(E)-dec-1-enyl]benzoyl]amino]butanoic acid (PubChem CID 70541790) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is 4-[[4-[(E)-dec-1-enyl]benzoyl]amino]butanoic acid.
| Compound Name | 4-[[4-[(E)-dec-1-enyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 70541790 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 4-[[4-[(E)-dec-1-enyl]benzoyl]amino]butanoic acid |
| SMILES | CCCCCCCC/C=C/c1ccc(C(=O)NCCCC(=O)O)cc1 |
| InChI | InChI=1S/C21H31NO3/c1-2-3-4-5-6-7-8-9-11-18-13-15-19(16-14-18)21(25)22-17-10-12-20(23)24/h9,11,13-16H,2-8,10,12,17H2,1H3,(H,22,25)(H,23,24)/b11-9+ |
| InChIKey | YIPNCHNDVAJOFP-PKNBQFBNSA-N |
| XLogP | 5.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|