C21H31NO4 — CID 57265083
4-[[2-(4-non-1-enylphenyl)-2-oxoethoxy]amino]butanoic acid (PubChem CID 57265083) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is 4-[[2-(4-non-1-enylphenyl)-2-oxoethoxy]amino]butanoic acid.
| Compound Name | 4-[[2-(4-non-1-enylphenyl)-2-oxoethoxy]amino]butanoic acid |
|---|---|
| PubChem CID | 57265083 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 4-[[2-(4-non-1-enylphenyl)-2-oxoethoxy]amino]butanoic acid |
| SMILES | CCCCCCCC=Cc1ccc(C(=O)CONCCCC(=O)O)cc1 |
| InChI | InChI=1S/C21H31NO4/c1-2-3-4-5-6-7-8-10-18-12-14-19(15-13-18)20(23)17-26-22-16-9-11-21(24)25/h8,10,12-15,22H,2-7,9,11,16-17H2,1H3,(H,24,25) |
| InChIKey | LJNBBPPFOJSTMI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|