C23H35NO4S — CID 54069213
4-[(4-dec-1-enylbenzoyl)-(methylsulfanylmethoxy)amino]butanoic acid (PubChem CID 54069213) has the molecular formula C23H35NO4S and a molecular weight of 421.60 g/mol. Its IUPAC name is 4-[(4-dec-1-enylbenzoyl)-(methylsulfanylmethoxy)amino]butanoic acid.
| Compound Name | 4-[(4-dec-1-enylbenzoyl)-(methylsulfanylmethoxy)amino]butanoic acid |
|---|---|
| PubChem CID | 54069213 |
| Molecular Formula | C23H35NO4S |
| Molecular Weight | 421.60 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 4-[(4-dec-1-enylbenzoyl)-(methylsulfanylmethoxy)amino]butanoic acid |
| SMILES | CCCCCCCCC=Cc1ccc(C(=O)N(CCCC(=O)O)OCSC)cc1 |
| InChI | InChI=1S/C23H35NO4S/c1-3-4-5-6-7-8-9-10-12-20-14-16-21(17-15-20)23(27)24(28-19-29-2)18-11-13-22(25)26/h10,12,14-17H,3-9,11,13,18-19H2,1-2H3,(H,25,26) |
| InChIKey | MFEVFUHERWKHBS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|