C10H11Cl2NO2 — CID 171368105
2,6-dichloro-N-methoxy-N,3-dimethylbenzamide (PubChem CID 171368105) has the molecular formula C10H11Cl2NO2 and a molecular weight of 248.11 g/mol. Its IUPAC name is 2,6-dichloro-N-methoxy-N,3-dimethylbenzamide.
| Compound Name | 2,6-dichloro-N-methoxy-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 171368105 |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 2,6-dichloro-N-methoxy-N,3-dimethylbenzamide |
| SMILES | CON(C)C(=O)c1c(Cl)ccc(C)c1Cl |
| InChI | InChI=1S/C10H11Cl2NO2/c1-6-4-5-7(11)8(9(6)12)10(14)13(2)15-3/h4-5H,1-3H3 |
| InChIKey | PEVHXUBORQWWLK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|