C8H10Cl2N2O2 — CID 134477966
2,4-dichloro-N-methoxy-N-methyl-1,2-dihydropyridine-5-carboxamide (PubChem CID 134477966) has the molecular formula C8H10Cl2N2O2 and a molecular weight of 237.09 g/mol. Its IUPAC name is 2,4-dichloro-N-methoxy-N-methyl-1,2-dihydropyridine-5-carboxamide.
| Compound Name | 2,4-dichloro-N-methoxy-N-methyl-1,2-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 134477966 |
| Molecular Formula | C8H10Cl2N2O2 |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 2,4-dichloro-N-methoxy-N-methyl-1,2-dihydropyridine-5-carboxamide |
| SMILES | CON(C)C(=O)C1=CNC(Cl)C=C1Cl |
| InChI | InChI=1S/C8H10Cl2N2O2/c1-12(14-2)8(13)5-4-11-7(10)3-6(5)9/h3-4,7,11H,1-2H3 |
| InChIKey | UNUKHIZWLVYACX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|