About 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide
2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide (PubChem CID 118609202) has the molecular formula C13H13BrN2O3S
and a molecular weight of 357.23 g/mol. Its IUPAC name is 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 118609202 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide |
| SMILES | COc1nc(-c2ccccc2Br)sc1C(=O)N(C)OC |
| InChI | InChI=1S/C13H13BrN2O3S/c1-16(19-3)13(17)10-11(18-2)15-12(20-10)8-6-4-5-7-9(8)14/h4-7H,1-3H3 |
| InChIKey | UWKDMVICNVRNFM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide (CID 118609202) is 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide is COc1nc(-c2ccccc2Br)sc1C(=O)N(C)OC.
What is the InChIKey of 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide?
The InChIKey is UWKDMVICNVRNFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrN2O3S/c1-16(19-3)13(17)10-11(18-2)15-12(20-10)8-6-4-5-7-9(8)14/h4-7H,1-3H3.
What are the key properties of 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide?
2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide has a molecular weight of 357.23 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenyl)-N,4-dimethoxy-N-methyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 118609202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).