C7H10BrN3O2 — CID 130752501
3-bromo-N-methoxy-N,1-dimethylpyrazole-5-carboxamide (PubChem CID 130752501) has the molecular formula C7H10BrN3O2 and a molecular weight of 248.08 g/mol. Its IUPAC name is 3-bromo-N-methoxy-N,1-dimethylpyrazole-5-carboxamide.
| Compound Name | 3-bromo-N-methoxy-N,1-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 130752501 |
| Molecular Formula | C7H10BrN3O2 |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 3-bromo-N-methoxy-N,1-dimethylpyrazole-5-carboxamide |
| SMILES | CON(C)C(=O)c1cc(Br)nn1C |
| InChI | InChI=1S/C7H10BrN3O2/c1-10-5(4-6(8)9-10)7(12)11(2)13-3/h4H,1-3H3 |
| InChIKey | NTOWEVZEZRABDC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|