C9H13N3O4 — CID 58072435
N,4-dimethoxy-N,1-dimethyl-6-oxopyridazine-3-carboxamide (PubChem CID 58072435) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is N,4-dimethoxy-N,1-dimethyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N,4-dimethoxy-N,1-dimethyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 58072435 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N,4-dimethoxy-N,1-dimethyl-6-oxopyridazine-3-carboxamide |
| SMILES | COc1cc(=O)n(C)nc1C(=O)N(C)OC |
| InChI | InChI=1S/C9H13N3O4/c1-11-7(13)5-6(15-3)8(10-11)9(14)12(2)16-4/h5H,1-4H3 |
| InChIKey | XZHJXZWTLSGLKA-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|