C9H15N3O2 — CID 54393293
4-ethyl-N-methoxy-N,1-dimethylpyrazole-3-carboxamide (PubChem CID 54393293) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-ethyl-N-methoxy-N,1-dimethylpyrazole-3-carboxamide.
| Compound Name | 4-ethyl-N-methoxy-N,1-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 54393293 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-ethyl-N-methoxy-N,1-dimethylpyrazole-3-carboxamide |
| SMILES | CCc1cn(C)nc1C(=O)N(C)OC |
| InChI | InChI=1S/C9H15N3O2/c1-5-7-6-11(2)10-8(7)9(13)12(3)14-4/h6H,5H2,1-4H3 |
| InChIKey | VIEKEBKHGNBHDW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|