C10H16N2O4 — CID 178053376
methyl 4-(3-hydroxy-3-methoxypropyl)-1-methylpyrazole-3-carboxylate (PubChem CID 178053376) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is methyl 4-(3-hydroxy-3-methoxypropyl)-1-methylpyrazole-3-carboxylate.
| Compound Name | methyl 4-(3-hydroxy-3-methoxypropyl)-1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 178053376 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | methyl 4-(3-hydroxy-3-methoxypropyl)-1-methylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(C)cc1CCC(O)OC |
| InChI | InChI=1S/C10H16N2O4/c1-12-6-7(4-5-8(13)15-2)9(11-12)10(14)16-3/h6,8,13H,4-5H2,1-3H3 |
| InChIKey | MQZZRPRHOCERAT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|