C9H13IN2O5 — CID 20978963
methyl 1-(1,3-dihydroxypropoxymethyl)-4-iodopyrazole-3-carboxylate (PubChem CID 20978963) has the molecular formula C9H13IN2O5 and a molecular weight of 356.12 g/mol. Its IUPAC name is methyl 1-(1,3-dihydroxypropoxymethyl)-4-iodopyrazole-3-carboxylate.
| Compound Name | methyl 1-(1,3-dihydroxypropoxymethyl)-4-iodopyrazole-3-carboxylate |
|---|---|
| PubChem CID | 20978963 |
| Molecular Formula | C9H13IN2O5 |
| Molecular Weight | 356.12 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | methyl 1-(1,3-dihydroxypropoxymethyl)-4-iodopyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(COC(O)CCO)cc1I |
| InChI | InChI=1S/C9H13IN2O5/c1-16-9(15)8-6(10)4-12(11-8)5-17-7(14)2-3-13/h4,7,13-14H,2-3,5H2,1H3 |
| InChIKey | CJMTVCOPKBPESZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.12 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|