C7H10IN3O — CID 19262123
N-ethyl-4-iodo-1-methylpyrazole-3-carboxamide (PubChem CID 19262123) has the molecular formula C7H10IN3O and a molecular weight of 279.08 g/mol. Its IUPAC name is N-ethyl-4-iodo-1-methylpyrazole-3-carboxamide.
| Compound Name | N-ethyl-4-iodo-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19262123 |
| Molecular Formula | C7H10IN3O |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | N-ethyl-4-iodo-1-methylpyrazole-3-carboxamide |
| SMILES | CCNC(=O)c1nn(C)cc1I |
| InChI | InChI=1S/C7H10IN3O/c1-3-9-7(12)6-5(8)4-11(2)10-6/h4H,3H2,1-2H3,(H,9,12) |
| InChIKey | PDAFDEGAFNMRSH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|