C11H8BrFIN3O — CID 19261907
N-(4-bromo-2-fluorophenyl)-4-iodo-1-methylpyrazole-3-carboxamide (PubChem CID 19261907) has the molecular formula C11H8BrFIN3O and a molecular weight of 424.01 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-4-iodo-1-methylpyrazole-3-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-4-iodo-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19261907 |
| Molecular Formula | C11H8BrFIN3O |
| Molecular Weight | 424.01 g/mol |
| Exact Mass | 422.89 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-4-iodo-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(I)c(C(=O)Nc2ccc(Br)cc2F)n1 |
| InChI | InChI=1S/C11H8BrFIN3O/c1-17-5-8(14)10(16-17)11(18)15-9-3-2-6(12)4-7(9)13/h2-5H,1H3,(H,15,18) |
| InChIKey | URFPJDYSUFUTMY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.01 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|