C12H7BrClF4N3O — CID 19481522
N-(4-bromo-2-fluorophenyl)-4-chloro-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 19481522) has the molecular formula C12H7BrClF4N3O and a molecular weight of 400.56 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-4-chloro-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-4-chloro-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19481522 |
| Molecular Formula | C12H7BrClF4N3O |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 398.94 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-4-chloro-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)c(Cl)c1C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H7BrClF4N3O/c1-21-9(8(14)10(20-21)12(16,17)18)11(22)19-7-3-2-5(13)4-6(7)15/h2-4H,1H3,(H,19,22) |
| InChIKey | BUTYGEZROGDFMB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |