C13H7ClF3N5O3 — CID 19481744
4-chloro-N-(2-cyano-4-nitrophenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 19481744) has the molecular formula C13H7ClF3N5O3 and a molecular weight of 373.68 g/mol. Its IUPAC name is 4-chloro-N-(2-cyano-4-nitrophenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-(2-cyano-4-nitrophenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19481744 |
| Molecular Formula | C13H7ClF3N5O3 |
| Molecular Weight | 373.68 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 4-chloro-N-(2-cyano-4-nitrophenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)c(Cl)c1C(=O)Nc1ccc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C13H7ClF3N5O3/c1-21-10(9(14)11(20-21)13(15,16)17)12(23)19-8-3-2-7(22(24)25)4-6(8)5-18/h2-4H,1H3,(H,19,23) |
| InChIKey | LRRURGZSDVWCHV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.68 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|