C12H9ClF3N3O2 — CID 19506719
4-chloro-N-(3-hydroxyphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 19506719) has the molecular formula C12H9ClF3N3O2 and a molecular weight of 319.67 g/mol. Its IUPAC name is 4-chloro-N-(3-hydroxyphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-(3-hydroxyphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19506719 |
| Molecular Formula | C12H9ClF3N3O2 |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 4-chloro-N-(3-hydroxyphenyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)c(Cl)c1C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C12H9ClF3N3O2/c1-19-9(8(13)10(18-19)12(14,15)16)11(21)17-6-3-2-4-7(20)5-6/h2-5,20H,1H3,(H,17,21) |
| InChIKey | CRIQEUBZPRNTJI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |