C8H9ClF3N3O2 — CID 19481557
4-chloro-N-(2-hydroxyethyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 19481557) has the molecular formula C8H9ClF3N3O2 and a molecular weight of 271.63 g/mol. Its IUPAC name is 4-chloro-N-(2-hydroxyethyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 4-chloro-N-(2-hydroxyethyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19481557 |
| Molecular Formula | C8H9ClF3N3O2 |
| Molecular Weight | 271.63 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 4-chloro-N-(2-hydroxyethyl)-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)c(Cl)c1C(=O)NCCO |
| InChI | InChI=1S/C8H9ClF3N3O2/c1-15-5(7(17)13-2-3-16)4(9)6(14-15)8(10,11)12/h16H,2-3H2,1H3,(H,13,17) |
| InChIKey | USRNTNYXYFUIRZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.63 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |