C10H11ClF3N7OS — CID 118771309
4-chloro-1-methyl-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 118771309) has the molecular formula C10H11ClF3N7OS and a molecular weight of 369.76 g/mol. Its IUPAC name is 4-chloro-1-methyl-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 4-chloro-1-methyl-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 118771309 |
| Molecular Formula | C10H11ClF3N7OS |
| Molecular Weight | 369.76 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 4-chloro-1-methyl-N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cn1nnnc1SCCNC(=O)c1c(Cl)c(C(F)(F)F)nn1C |
| InChI | InChI=1S/C10H11ClF3N7OS/c1-20-6(5(11)7(17-20)10(12,13)14)8(22)15-3-4-23-9-16-18-19-21(9)2/h3-4H2,1-2H3,(H,15,22) |
| InChIKey | LDQHQZQHBHPSID-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.76 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|