C11H9ClF3N3OS — CID 4772994
4-chloro-1-methyl-N-(thiophen-2-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 4772994) has the molecular formula C11H9ClF3N3OS and a molecular weight of 323.73 g/mol. Its IUPAC name is 4-chloro-1-methyl-N-(thiophen-2-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 4-chloro-1-methyl-N-(thiophen-2-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4772994 |
| Molecular Formula | C11H9ClF3N3OS |
| Molecular Weight | 323.73 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 4-chloro-1-methyl-N-(thiophen-2-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)c(Cl)c1C(=O)NCc1cccs1 |
| InChI | InChI=1S/C11H9ClF3N3OS/c1-18-8(7(12)9(17-18)11(13,14)15)10(19)16-5-6-3-2-4-20-6/h2-4H,5H2,1H3,(H,16,19) |
| InChIKey | BZQMUBSIIGJUGN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.73 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |