C12H11IN4O2 — CID 135411998
N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide (PubChem CID 135411998) has the molecular formula C12H11IN4O2 and a molecular weight of 370.15 g/mol. Its IUPAC name is N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135411998 |
| Molecular Formula | C12H11IN4O2 |
| Molecular Weight | 370.15 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-4-iodo-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(I)c(C(=O)N/N=C/c2ccc(O)cc2)n1 |
| InChI | InChI=1S/C12H11IN4O2/c1-17-7-10(13)11(16-17)12(19)15-14-6-8-2-4-9(18)5-3-8/h2-7,18H,1H3,(H,15,19)/b14-6+ |
| InChIKey | UHKNKIDDBTXVOR-MKMNVTDBSA-N |
| XLogP | 1.49 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.15 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|