C7H10N2O3 — CID 10607232
5,6-dimethoxy-2-methylpyridazin-3-one (PubChem CID 10607232) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 5,6-dimethoxy-2-methylpyridazin-3-one.
| Compound Name | 5,6-dimethoxy-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 10607232 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 5,6-dimethoxy-2-methylpyridazin-3-one |
| SMILES | COc1cc(=O)n(C)nc1OC |
| InChI | InChI=1S/C7H10N2O3/c1-9-6(10)4-5(11-2)7(8-9)12-3/h4H,1-3H3 |
| InChIKey | XUODAGPRKYYJBN-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |