C13H12F2N2O3 — CID 101125632
2-[(3,4-difluorophenyl)methyl]-5,6-dimethoxypyridazin-3-one (PubChem CID 101125632) has the molecular formula C13H12F2N2O3 and a molecular weight of 282.25 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methyl]-5,6-dimethoxypyridazin-3-one.
| Compound Name | 2-[(3,4-difluorophenyl)methyl]-5,6-dimethoxypyridazin-3-one |
|---|---|
| PubChem CID | 101125632 |
| Molecular Formula | C13H12F2N2O3 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methyl]-5,6-dimethoxypyridazin-3-one |
| SMILES | COc1cc(=O)n(Cc2ccc(F)c(F)c2)nc1OC |
| InChI | InChI=1S/C13H12F2N2O3/c1-19-11-6-12(18)17(16-13(11)20-2)7-8-3-4-9(14)10(15)5-8/h3-6H,7H2,1-2H3 |
| InChIKey | VIHBOTZSZRQUIL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |