C15H16FN3O2 — CID 103219917
5-(cyclopropylamino)-2-[(3-fluoro-4-methoxyphenyl)methyl]pyridazin-3-one (PubChem CID 103219917) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 5-(cyclopropylamino)-2-[(3-fluoro-4-methoxyphenyl)methyl]pyridazin-3-one.
| Compound Name | 5-(cyclopropylamino)-2-[(3-fluoro-4-methoxyphenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103219917 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 5-(cyclopropylamino)-2-[(3-fluoro-4-methoxyphenyl)methyl]pyridazin-3-one |
| SMILES | COc1ccc(Cn2ncc(NC3CC3)cc2=O)cc1F |
| InChI | InChI=1S/C15H16FN3O2/c1-21-14-5-2-10(6-13(14)16)9-19-15(20)7-12(8-17-19)18-11-3-4-11/h2,5-8,11,18H,3-4,9H2,1H3 |
| InChIKey | PMRCRWPTJIEYOF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |