C15H15BrFN3O — CID 103220665
2-[(2-bromo-3-fluorophenyl)methyl]-5-(cyclobutylamino)pyridazin-3-one (PubChem CID 103220665) has the molecular formula C15H15BrFN3O and a molecular weight of 352.21 g/mol. Its IUPAC name is 2-[(2-bromo-3-fluorophenyl)methyl]-5-(cyclobutylamino)pyridazin-3-one.
| Compound Name | 2-[(2-bromo-3-fluorophenyl)methyl]-5-(cyclobutylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 103220665 |
| Molecular Formula | C15H15BrFN3O |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-[(2-bromo-3-fluorophenyl)methyl]-5-(cyclobutylamino)pyridazin-3-one |
| SMILES | O=c1cc(NC2CCC2)cnn1Cc1cccc(F)c1Br |
| InChI | InChI=1S/C15H15BrFN3O/c16-15-10(3-1-6-13(15)17)9-20-14(21)7-12(8-18-20)19-11-4-2-5-11/h1,3,6-8,11,19H,2,4-5,9H2 |
| InChIKey | ZNLCVOKSEWHCRB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |