C15H15Cl2N3O — CID 103220558
5-(cyclobutylamino)-2-[(2,4-dichlorophenyl)methyl]pyridazin-3-one (PubChem CID 103220558) has the molecular formula C15H15Cl2N3O and a molecular weight of 324.21 g/mol. Its IUPAC name is 5-(cyclobutylamino)-2-[(2,4-dichlorophenyl)methyl]pyridazin-3-one.
| Compound Name | 5-(cyclobutylamino)-2-[(2,4-dichlorophenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103220558 |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 5-(cyclobutylamino)-2-[(2,4-dichlorophenyl)methyl]pyridazin-3-one |
| SMILES | O=c1cc(NC2CCC2)cnn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H15Cl2N3O/c16-11-5-4-10(14(17)6-11)9-20-15(21)7-13(8-18-20)19-12-2-1-3-12/h4-8,12,19H,1-3,9H2 |
| InChIKey | GKFUQYRPFLJXCU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |