C14H19N5O — CID 103219677
5-(cyclopropylamino)-2-[(3-ethyl-1-methylpyrazol-5-yl)methyl]pyridazin-3-one (PubChem CID 103219677) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-(cyclopropylamino)-2-[(3-ethyl-1-methylpyrazol-5-yl)methyl]pyridazin-3-one.
| Compound Name | 5-(cyclopropylamino)-2-[(3-ethyl-1-methylpyrazol-5-yl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103219677 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 5-(cyclopropylamino)-2-[(3-ethyl-1-methylpyrazol-5-yl)methyl]pyridazin-3-one |
| SMILES | CCc1cc(Cn2ncc(NC3CC3)cc2=O)n(C)n1 |
| InChI | InChI=1S/C14H19N5O/c1-3-10-6-13(18(2)17-10)9-19-14(20)7-12(8-15-19)16-11-4-5-11/h6-8,11,16H,3-5,9H2,1-2H3 |
| InChIKey | YDJOOLCUZSFLMP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |