C13H20N6O — CID 103220996
5-(2-aminoethylamino)-2-[(3-ethyl-1-methylpyrazol-5-yl)methyl]pyridazin-3-one (PubChem CID 103220996) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-(2-aminoethylamino)-2-[(3-ethyl-1-methylpyrazol-5-yl)methyl]pyridazin-3-one.
| Compound Name | 5-(2-aminoethylamino)-2-[(3-ethyl-1-methylpyrazol-5-yl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103220996 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 5-(2-aminoethylamino)-2-[(3-ethyl-1-methylpyrazol-5-yl)methyl]pyridazin-3-one |
| SMILES | CCc1cc(Cn2ncc(NCCN)cc2=O)n(C)n1 |
| InChI | InChI=1S/C13H20N6O/c1-3-10-6-12(18(2)17-10)9-19-13(20)7-11(8-16-19)15-5-4-14/h6-8,15H,3-5,9,14H2,1-2H3 |
| InChIKey | VHLKTLLEEXMHBQ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |