C13H19ClN6O — CID 103221139
5-(2-aminoethylamino)-2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]pyridazin-3-one (PubChem CID 103221139) has the molecular formula C13H19ClN6O and a molecular weight of 310.79 g/mol. Its IUPAC name is 5-(2-aminoethylamino)-2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]pyridazin-3-one.
| Compound Name | 5-(2-aminoethylamino)-2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103221139 |
| Molecular Formula | C13H19ClN6O |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5-(2-aminoethylamino)-2-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]pyridazin-3-one |
| SMILES | CCn1nc(C)c(Cl)c1Cn1ncc(NCCN)cc1=O |
| InChI | InChI=1S/C13H19ClN6O/c1-3-19-11(13(14)9(2)18-19)8-20-12(21)6-10(7-17-20)16-5-4-15/h6-7,16H,3-5,8,15H2,1-2H3 |
| InChIKey | LISHIYSRWKXFSP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |