C15H17N3O4 — CID 58072218
N,4-dimethoxy-N-methyl-1-(3-methylphenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 58072218) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is N,4-dimethoxy-N-methyl-1-(3-methylphenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N,4-dimethoxy-N-methyl-1-(3-methylphenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 58072218 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N,4-dimethoxy-N-methyl-1-(3-methylphenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | COc1cc(=O)n(-c2cccc(C)c2)nc1C(=O)N(C)OC |
| InChI | InChI=1S/C15H17N3O4/c1-10-6-5-7-11(8-10)18-13(19)9-12(21-3)14(16-18)15(20)17(2)22-4/h5-9H,1-4H3 |
| InChIKey | YZLAKMKCOJJABR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|