C18H15N3O4 — CID 8553640
N-(2-hydroxyphenyl)-4-methoxy-6-oxo-1-phenylpyridazine-3-carboxamide (PubChem CID 8553640) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-4-methoxy-6-oxo-1-phenylpyridazine-3-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-4-methoxy-6-oxo-1-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 8553640 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-(2-hydroxyphenyl)-4-methoxy-6-oxo-1-phenylpyridazine-3-carboxamide |
| SMILES | COc1cc(=O)n(-c2ccccc2)nc1C(=O)Nc1ccccc1O |
| InChI | InChI=1S/C18H15N3O4/c1-25-15-11-16(23)21(12-7-3-2-4-8-12)20-17(15)18(24)19-13-9-5-6-10-14(13)22/h2-11,22H,1H3,(H,19,24) |
| InChIKey | BSSFYMCDFAODEU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|