C18H13FN4O5 — CID 8553999
N-(4-fluoro-3-nitrophenyl)-4-methoxy-6-oxo-1-phenylpyridazine-3-carboxamide (PubChem CID 8553999) has the molecular formula C18H13FN4O5 and a molecular weight of 384.32 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-4-methoxy-6-oxo-1-phenylpyridazine-3-carboxamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-4-methoxy-6-oxo-1-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 8553999 |
| Molecular Formula | C18H13FN4O5 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-4-methoxy-6-oxo-1-phenylpyridazine-3-carboxamide |
| SMILES | COc1cc(=O)n(-c2ccccc2)nc1C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13FN4O5/c1-28-15-10-16(24)22(12-5-3-2-4-6-12)21-17(15)18(25)20-11-7-8-13(19)14(9-11)23(26)27/h2-10H,1H3,(H,20,25) |
| InChIKey | ISFLAPKQDOHIGC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|