C9H12N2O3 — CID 60731291
N-methoxy-N,1-dimethyl-2-oxopyridine-4-carboxamide (PubChem CID 60731291) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is N-methoxy-N,1-dimethyl-2-oxopyridine-4-carboxamide.
| Compound Name | N-methoxy-N,1-dimethyl-2-oxopyridine-4-carboxamide |
|---|---|
| PubChem CID | 60731291 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N-methoxy-N,1-dimethyl-2-oxopyridine-4-carboxamide |
| SMILES | CON(C)C(=O)c1ccn(C)c(=O)c1 |
| InChI | InChI=1S/C9H12N2O3/c1-10-5-4-7(6-8(10)12)9(13)11(2)14-3/h4-6H,1-3H3 |
| InChIKey | BQEDMDPXRRGSCU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|