C12H10Br2FN3O2 — CID 118447589
2-(2,6-dibromo-4-fluorophenyl)-N-methoxy-N-methylpyrazole-3-carboxamide (PubChem CID 118447589) has the molecular formula C12H10Br2FN3O2 and a molecular weight of 407.04 g/mol. Its IUPAC name is 2-(2,6-dibromo-4-fluorophenyl)-N-methoxy-N-methylpyrazole-3-carboxamide.
| Compound Name | 2-(2,6-dibromo-4-fluorophenyl)-N-methoxy-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 118447589 |
| Molecular Formula | C12H10Br2FN3O2 |
| Molecular Weight | 407.04 g/mol |
| Exact Mass | 404.91 |
| IUPAC Name | 2-(2,6-dibromo-4-fluorophenyl)-N-methoxy-N-methylpyrazole-3-carboxamide |
| SMILES | CON(C)C(=O)c1ccnn1-c1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C12H10Br2FN3O2/c1-17(20-2)12(19)10-3-4-16-18(10)11-8(13)5-7(15)6-9(11)14/h3-6H,1-2H3 |
| InChIKey | IQUUNIBISXZNBV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.04 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|