C11H23BN2O5Si — CID 175420636
[4-(methoxymethyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]oxyboronic acid (PubChem CID 175420636) has the molecular formula C11H23BN2O5Si and a molecular weight of 302.21 g/mol. Its IUPAC name is [4-(methoxymethyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]oxyboronic acid.
| Compound Name | [4-(methoxymethyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]oxyboronic acid |
|---|---|
| PubChem CID | 175420636 |
| Molecular Formula | C11H23BN2O5Si |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [4-(methoxymethyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]oxyboronic acid |
| SMILES | COCc1cn(COCC[Si](C)(C)C)nc1OB(O)O |
| InChI | InChI=1S/C11H23BN2O5Si/c1-17-8-10-7-14(13-11(10)19-12(15)16)9-18-5-6-20(2,3)4/h7,15-16H,5-6,8-9H2,1-4H3 |
| InChIKey | OYYAVWCUEAVOKX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|