C16H24N2O4Si — CID 171799512
7-(methoxymethyl)-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxylic acid (PubChem CID 171799512) has the molecular formula C16H24N2O4Si and a molecular weight of 336.46 g/mol. Its IUPAC name is 7-(methoxymethyl)-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxylic acid.
| Compound Name | 7-(methoxymethyl)-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 171799512 |
| Molecular Formula | C16H24N2O4Si |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 7-(methoxymethyl)-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carboxylic acid |
| SMILES | COCc1cc(C(=O)O)cc2c1ncn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H24N2O4Si/c1-21-9-13-7-12(16(19)20)8-14-15(13)17-10-18(14)11-22-5-6-23(2,3)4/h7-8,10H,5-6,9,11H2,1-4H3,(H,19,20) |
| InChIKey | VNOMVGARJXQQEV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|