C13H19ClN2O3SSi — CID 155711383
1-(2-trimethylsilylethoxymethyl)benzimidazole-4-sulfonyl chloride (PubChem CID 155711383) has the molecular formula C13H19ClN2O3SSi and a molecular weight of 346.91 g/mol. Its IUPAC name is 1-(2-trimethylsilylethoxymethyl)benzimidazole-4-sulfonyl chloride.
| Compound Name | 1-(2-trimethylsilylethoxymethyl)benzimidazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 155711383 |
| Molecular Formula | C13H19ClN2O3SSi |
| Molecular Weight | 346.91 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 1-(2-trimethylsilylethoxymethyl)benzimidazole-4-sulfonyl chloride |
| SMILES | C[Si](C)(C)CCOCn1cnc2c(S(=O)(=O)Cl)cccc21 |
| InChI | InChI=1S/C13H19ClN2O3SSi/c1-21(2,3)8-7-19-10-16-9-15-13-11(16)5-4-6-12(13)20(14,17)18/h4-6,9H,7-8,10H2,1-3H3 |
| InChIKey | AAXKSUZVNXYMLY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.91 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|