C17H25NO4Si — CID 22742897
1-ethyl-4-(2-trimethylsilylethoxymethoxy)indole-6-carboxylic acid (PubChem CID 22742897) has the molecular formula C17H25NO4Si and a molecular weight of 335.48 g/mol. Its IUPAC name is 1-ethyl-4-(2-trimethylsilylethoxymethoxy)indole-6-carboxylic acid.
| Compound Name | 1-ethyl-4-(2-trimethylsilylethoxymethoxy)indole-6-carboxylic acid |
|---|---|
| PubChem CID | 22742897 |
| Molecular Formula | C17H25NO4Si |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-ethyl-4-(2-trimethylsilylethoxymethoxy)indole-6-carboxylic acid |
| SMILES | CCn1ccc2c(OCOCC[Si](C)(C)C)cc(C(=O)O)cc21 |
| InChI | InChI=1S/C17H25NO4Si/c1-5-18-7-6-14-15(18)10-13(17(19)20)11-16(14)22-12-21-8-9-23(2,3)4/h6-7,10-11H,5,8-9,12H2,1-4H3,(H,19,20) |
| InChIKey | DIVWPSLMCDGGIR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|