C20H27NO6Si — CID 58580277
methyl 1-[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]-2-oxopyridine-4-carboxylate (PubChem CID 58580277) has the molecular formula C20H27NO6Si and a molecular weight of 405.52 g/mol. Its IUPAC name is methyl 1-[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]-2-oxopyridine-4-carboxylate.
| Compound Name | methyl 1-[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]-2-oxopyridine-4-carboxylate |
|---|---|
| PubChem CID | 58580277 |
| Molecular Formula | C20H27NO6Si |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methyl 1-[3-methoxy-4-(2-trimethylsilylethoxymethoxy)phenyl]-2-oxopyridine-4-carboxylate |
| SMILES | COC(=O)c1ccn(-c2ccc(OCOCC[Si](C)(C)C)c(OC)c2)c(=O)c1 |
| InChI | InChI=1S/C20H27NO6Si/c1-24-18-13-16(21-9-8-15(12-19(21)22)20(23)25-2)6-7-17(18)27-14-26-10-11-28(3,4)5/h6-9,12-13H,10-11,14H2,1-5H3 |
| InChIKey | XFIQWGPRBAWKAS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|