C19H20N4O5 — CID 55841019
methyl 4-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethoxy]benzoate (PubChem CID 55841019) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is methyl 4-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethoxy]benzoate.
| Compound Name | methyl 4-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethoxy]benzoate |
|---|---|
| PubChem CID | 55841019 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | methyl 4-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCn2nnc(-c3ccc(OC)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C19H20N4O5/c1-25-16-9-6-14(12-17(16)26-2)18-20-22-23(21-18)10-11-28-15-7-4-13(5-8-15)19(24)27-3/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | GIKCTHORACHXCY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |