C12H16N4O4S — CID 55410639
5-(3,4-dimethoxyphenyl)-2-(2-methylsulfonylethyl)tetrazole (PubChem CID 55410639) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-2-(2-methylsulfonylethyl)tetrazole.
| Compound Name | 5-(3,4-dimethoxyphenyl)-2-(2-methylsulfonylethyl)tetrazole |
|---|---|
| PubChem CID | 55410639 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-2-(2-methylsulfonylethyl)tetrazole |
| SMILES | COc1ccc(-c2nnn(CCS(C)(=O)=O)n2)cc1OC |
| InChI | InChI=1S/C12H16N4O4S/c1-19-10-5-4-9(8-11(10)20-2)12-13-15-16(14-12)6-7-21(3,17)18/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | CAZMVRMNMMRORI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |