C10H12N6O2 — CID 43831132
2-[5-(3-amino-4-methoxyphenyl)tetrazol-2-yl]acetamide (PubChem CID 43831132) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is 2-[5-(3-amino-4-methoxyphenyl)tetrazol-2-yl]acetamide.
| Compound Name | 2-[5-(3-amino-4-methoxyphenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 43831132 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-[5-(3-amino-4-methoxyphenyl)tetrazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2nnn(CC(N)=O)n2)cc1N |
| InChI | InChI=1S/C10H12N6O2/c1-18-8-3-2-6(4-7(8)11)10-13-15-16(14-10)5-9(12)17/h2-4H,5,11H2,1H3,(H2,12,17) |
| InChIKey | KKHIBVUZKXPHPB-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 121.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|