C12H13N4O4- — CID 7353447
2-[5-(3-ethoxy-4-methoxyphenyl)tetrazol-2-yl]acetate (PubChem CID 7353447) has the molecular formula C12H13N4O4- and a molecular weight of 277.26 g/mol. Its IUPAC name is 2-[5-(3-ethoxy-4-methoxyphenyl)tetrazol-2-yl]acetate.
| Compound Name | 2-[5-(3-ethoxy-4-methoxyphenyl)tetrazol-2-yl]acetate |
|---|---|
| PubChem CID | 7353447 |
| Molecular Formula | C12H13N4O4- |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-[5-(3-ethoxy-4-methoxyphenyl)tetrazol-2-yl]acetate |
| SMILES | CCOc1cc(-c2nnn(CC(=O)[O-])n2)ccc1OC |
| InChI | InChI=1S/C12H14N4O4/c1-3-20-10-6-8(4-5-9(10)19-2)12-13-15-16(14-12)7-11(17)18/h4-6H,3,7H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | UDSAPVBBVOEZDZ-UHFFFAOYSA-M |
| XLogP | -0.50 |
| TPSA | 102.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |