C18H18FN5O3 — CID 19798541
2-[5-(3-ethoxy-4-methoxyphenyl)tetrazol-2-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 19798541) has the molecular formula C18H18FN5O3 and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-[5-(3-ethoxy-4-methoxyphenyl)tetrazol-2-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[5-(3-ethoxy-4-methoxyphenyl)tetrazol-2-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 19798541 |
| Molecular Formula | C18H18FN5O3 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-[5-(3-ethoxy-4-methoxyphenyl)tetrazol-2-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | CCOc1cc(-c2nnn(CC(=O)Nc3cccc(F)c3)n2)ccc1OC |
| InChI | InChI=1S/C18H18FN5O3/c1-3-27-16-9-12(7-8-15(16)26-2)18-21-23-24(22-18)11-17(25)20-14-6-4-5-13(19)10-14/h4-10H,3,11H2,1-2H3,(H,20,25) |
| InChIKey | FIMGQXZFTPLAFJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |