C19H19FN6O3 — CID 18273197
2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methylacetamide (PubChem CID 18273197) has the molecular formula C19H19FN6O3 and a molecular weight of 398.40 g/mol. Its IUPAC name is 2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methylacetamide.
| Compound Name | 2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 18273197 |
| Molecular Formula | C19H19FN6O3 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-[2-(3-methoxyanilino)-2-oxoethyl]-N-methylacetamide |
| SMILES | COc1cccc(NC(=O)CN(C)C(=O)Cn2nnc(-c3cccc(F)c3)n2)c1 |
| InChI | InChI=1S/C19H19FN6O3/c1-25(11-17(27)21-15-7-4-8-16(10-15)29-2)18(28)12-26-23-19(22-24-26)13-5-3-6-14(20)9-13/h3-10H,11-12H2,1-2H3,(H,21,27) |
| InChIKey | MMUVWIYULJMEGK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |