C17H17N5O2S — CID 26676812
2-[5-(3-methoxyphenyl)tetrazol-2-yl]-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 26676812) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[5-(3-methoxyphenyl)tetrazol-2-yl]-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[5-(3-methoxyphenyl)tetrazol-2-yl]-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 26676812 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[5-(3-methoxyphenyl)tetrazol-2-yl]-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | COc1cccc(-c2nnn(CC(=O)Nc3cccc(SC)c3)n2)c1 |
| InChI | InChI=1S/C17H17N5O2S/c1-24-14-7-3-5-12(9-14)17-19-21-22(20-17)11-16(23)18-13-6-4-8-15(10-13)25-2/h3-10H,11H2,1-2H3,(H,18,23) |
| InChIKey | GLEHXGNACLDRRR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |