C18H21N5O4 — CID 1175335
2-[5-(3,4-diethoxyphenyl)tetrazol-2-yl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 1175335) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-[5-(3,4-diethoxyphenyl)tetrazol-2-yl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[5-(3,4-diethoxyphenyl)tetrazol-2-yl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 1175335 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-[5-(3,4-diethoxyphenyl)tetrazol-2-yl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCOc1ccc(-c2nnn(CC(=O)NCc3ccco3)n2)cc1OCC |
| InChI | InChI=1S/C18H21N5O4/c1-3-25-15-8-7-13(10-16(15)26-4-2)18-20-22-23(21-18)12-17(24)19-11-14-6-5-9-27-14/h5-10H,3-4,11-12H2,1-2H3,(H,19,24) |
| InChIKey | BISPFBIKTLHLRB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |