C15H13FN6O3 — CID 30823180
2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide (PubChem CID 30823180) has the molecular formula C15H13FN6O3 and a molecular weight of 344.31 g/mol. Its IUPAC name is 2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 30823180 |
| Molecular Formula | C15H13FN6O3 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 2-[5-(3-fluorophenyl)tetrazol-2-yl]-N-(furan-2-ylmethylcarbamoyl)acetamide |
| SMILES | O=C(Cn1nnc(-c2cccc(F)c2)n1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H13FN6O3/c16-11-4-1-3-10(7-11)14-19-21-22(20-14)9-13(23)18-15(24)17-8-12-5-2-6-25-12/h1-7H,8-9H2,(H2,17,18,23,24) |
| InChIKey | UCCBWJCMVVYJDU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |