C16H17N5O5 — CID 8678146
[2-oxo-2-(prop-2-ynylamino)ethyl] 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetate (PubChem CID 8678146) has the molecular formula C16H17N5O5 and a molecular weight of 359.34 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetate |
|---|---|
| PubChem CID | 8678146 |
| Molecular Formula | C16H17N5O5 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetate |
| SMILES | C#CCNC(=O)COC(=O)Cn1nnc(-c2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C16H17N5O5/c1-4-7-17-14(22)10-26-15(23)9-21-19-16(18-20-21)11-5-6-12(24-2)13(8-11)25-3/h1,5-6,8H,7,9-10H2,2-3H3,(H,17,22) |
| InChIKey | SVWSSERZSAAKLK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|