C18H20N4O3 — CID 52615802
5-(3,4-dimethoxyphenyl)-2-[2-(2-methylphenoxy)ethyl]tetrazole (PubChem CID 52615802) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-2-[2-(2-methylphenoxy)ethyl]tetrazole.
| Compound Name | 5-(3,4-dimethoxyphenyl)-2-[2-(2-methylphenoxy)ethyl]tetrazole |
|---|---|
| PubChem CID | 52615802 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-2-[2-(2-methylphenoxy)ethyl]tetrazole |
| SMILES | COc1ccc(-c2nnn(CCOc3ccccc3C)n2)cc1OC |
| InChI | InChI=1S/C18H20N4O3/c1-13-6-4-5-7-15(13)25-11-10-22-20-18(19-21-22)14-8-9-16(23-2)17(12-14)24-3/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | XVMCGMZIBFDQOF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |