C19H21N7O4S — CID 21149856
1-[[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetyl]amino]-3-(2-methylphenyl)sulfanylurea (PubChem CID 21149856) has the molecular formula C19H21N7O4S and a molecular weight of 443.49 g/mol. Its IUPAC name is 1-[[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetyl]amino]-3-(2-methylphenyl)sulfanylurea.
| Compound Name | 1-[[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetyl]amino]-3-(2-methylphenyl)sulfanylurea |
|---|---|
| PubChem CID | 21149856 |
| Molecular Formula | C19H21N7O4S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 1-[[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetyl]amino]-3-(2-methylphenyl)sulfanylurea |
| SMILES | COc1ccc(-c2nnn(CC(=O)NNC(=O)NSc3ccccc3C)n2)cc1OC |
| InChI | InChI=1S/C19H21N7O4S/c1-12-6-4-5-7-16(12)31-24-19(28)22-20-17(27)11-26-23-18(21-25-26)13-8-9-14(29-2)15(10-13)30-3/h4-10H,11H2,1-3H3,(H,20,27)(H2,22,24,28) |
| InChIKey | VGIHMWYYXDDVLP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|